Products 1305325-16-9
CAS 1305325-16-9 is the registry number for Methyl 2,5-dichloro-3-methoxyisonicotinate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 2,5-dichloro-3-methoxypyridine-4-carboxylate (CAS 1305325-16-9) is a chemical compound with the molecular formula C8H7Cl2NO3 and a molecular weight of 236.05 g/mol. IUPAC name: methyl 2,5-dichloro-3-methoxypyridine-4-carboxylate. InChIKey: MDWVIMXSSFZVFH-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO3 |
|---|---|
| Molecular weight | 236.05 g/mol |
| IUPAC name | methyl 2,5-dichloro-3-methoxypyridine-4-carboxylate |
| InChIKey | MDWVIMXSSFZVFH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CN=C1Cl)Cl)C(=O)OC |
Computed by PubChem (NCBI)