CAS 99817-36-4 appears in our catalog under these names: 2,4–Dichloro–3–ethyl–6–nitrophenol, 2,4-Dichloro-3-ethyl-6-nitrophenol, >98.0%(GC)(T), 2,4-Dichloro-3-ethyl-6-nitrophenol 98%, 2,4-Dichloro-3-ethyl-6-nitrophenol, 98%, 98%, 2,4-Dichloro-3-ethyl-6-nitrophenol, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 5g, 10g.
2,4-dichloro-3-ethyl-6-nitrophenol (CAS 99817-36-4) is a chemical compound with the molecular formula C8H7Cl2NO3 and a molecular weight of 236.05 g/mol. IUPAC name: 2,4-dichloro-3-ethyl-6-nitrophenol. InChIKey: YTVCECQSAPGJBB-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO3 |
|---|---|
| Molecular weight | 236.05 g/mol |
| IUPAC name | 2,4-dichloro-3-ethyl-6-nitrophenol |
| InChIKey | YTVCECQSAPGJBB-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C(=C1Cl)O)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)