Products 2921712-71-0
CAS 2921712-71-0 is the registry number for Methyl 2,6-dichloro-5-methoxynicotinate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2,6-dichloro-5-methoxypyridine-3-carboxylate (CAS 2921712-71-0) is a chemical compound with the molecular formula C8H7Cl2NO3 and a molecular weight of 236.05 g/mol. IUPAC name: methyl 2,6-dichloro-5-methoxypyridine-3-carboxylate. InChIKey: JKUXELRFAIELCU-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO3 |
|---|---|
| Molecular weight | 236.05 g/mol |
| IUPAC name | methyl 2,6-dichloro-5-methoxypyridine-3-carboxylate |
| InChIKey | JKUXELRFAIELCU-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C(=C1)C(=O)OC)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
Methyl 2,6-dichloro-5-methoxynicotinate