Products 62047-40-9
CAS 62047-40-9 appears in our catalog under these names: 1,3-Dichloro-2-ethoxy-5-nitrobenzene, 95%, 1,3-Dichloro-2-ethoxy-5-nitrobenzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g, 250mg.
1,3-dichloro-2-ethoxy-5-nitrobenzene (CAS 62047-40-9) is a chemical compound with the molecular formula C8H7Cl2NO3 and a molecular weight of 236.05 g/mol. IUPAC name: 1,3-dichloro-2-ethoxy-5-nitrobenzene. InChIKey: NRZAIWWKGAZYDY-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO3 |
|---|---|
| Molecular weight | 236.05 g/mol |
| IUPAC name | 1,3-dichloro-2-ethoxy-5-nitrobenzene |
| InChIKey | NRZAIWWKGAZYDY-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)