CAS 13054-64-3 appears in our catalog under these names: 5-Methyl-3-phenylisoxazol-4-ol, 98%, 5-Methyl-3-phenyl-1,2-oxazol-4-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-methyl-3-phenyl-1,2-oxazol-4-ol (CAS 13054-64-3) is a chemical compound with the molecular formula C10H9NO2 and a molecular weight of 175.18 g/mol. IUPAC name: 5-methyl-3-phenyl-1,2-oxazol-4-ol. InChIKey: BUZWHWOBEFSFJI-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2 |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 5-methyl-3-phenyl-1,2-oxazol-4-ol |
| InChIKey | BUZWHWOBEFSFJI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)O |
Computed by PubChem (NCBI)