CAS 1305463-63-1 is the registry number for 2-(tert-Butyl)-4-methylpyrimidine-5-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-tert-butyl-4-methylpyrimidine-5-carboxylic acid (CAS 1305463-63-1) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 2-tert-butyl-4-methylpyrimidine-5-carboxylic acid. InChIKey: UUTIDHXBOBGYSE-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-tert-butyl-4-methylpyrimidine-5-carboxylic acid |
| InChIKey | UUTIDHXBOBGYSE-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC=C1C(=O)O)C(C)(C)C |
Computed by PubChem (NCBI)