CAS 1305567-43-4 appears in our catalog under these names: 4-{((3-Methylphenyl)methyl)carbamoyl}benzoic acid, 4-{((3-methylphenyl)methyl)carbamoyl}benzoic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
4-[(3-methylphenyl)methylcarbamoyl]benzoic acid (CAS 1305567-43-4) is a chemical compound with the molecular formula C16H15NO3 and a molecular weight of 269.29 g/mol. IUPAC name: 4-[(3-methylphenyl)methylcarbamoyl]benzoic acid. InChIKey: HGJBFFZNDYETDP-UHFFFAOYSA-N.
| Molecular formula | C16H15NO3 |
|---|---|
| Molecular weight | 269.29 g/mol |
| IUPAC name | 4-[(3-methylphenyl)methylcarbamoyl]benzoic acid |
| InChIKey | HGJBFFZNDYETDP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)CNC(=O)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)