CAS 1305710-90-0 is the registry number for 2-{5,7-Dimethyl-2-oxo-1H,2H,4H,5H,6H,7H-pyrazolo(1,5-a)pyrimidin-6-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5,7-dimethyl-2-oxo-4,5,6,7-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetic acid (CAS 1305710-90-0) is a chemical compound with the molecular formula C10H15N3O3 and a molecular weight of 225.24 g/mol. IUPAC name: 2-(5,7-dimethyl-2-oxo-4,5,6,7-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetic acid. InChIKey: IQVCQXBOZQQVLK-UHFFFAOYSA-N.
| Molecular formula | C10H15N3O3 |
|---|---|
| Molecular weight | 225.24 g/mol |
| IUPAC name | 2-(5,7-dimethyl-2-oxo-4,5,6,7-tetrahydro-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetic acid |
| InChIKey | IQVCQXBOZQQVLK-UHFFFAOYSA-N |
| SMILES | CC1C(C(N2C(=CC(=O)N2)N1)C)CC(=O)O |
Computed by PubChem (NCBI)