Products 1305712-39-3
CAS 1305712-39-3 is the registry number for 3-{(1-(4-Bromophenyl)-1-oxopropan-2-yl)carbamoyl}propanoic acid. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-[[1-(4-bromophenyl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid (CAS 1305712-39-3) is a chemical compound with the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. IUPAC name: 4-[[1-(4-bromophenyl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid. InChIKey: KWGXOYPDYCWYET-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO4 |
|---|---|
| Molecular weight | 328.16 g/mol |
| IUPAC name | 4-[[1-(4-bromophenyl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | KWGXOYPDYCWYET-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC=C(C=C1)Br)NC(=O)CCC(=O)O |
Computed by PubChem (NCBI)