CAS 144332-75-2 is the registry number for (2S)-1-{((4-Bromophenyl)methoxy)carbonyl}pyrrolidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2S)-1-[(4-bromophenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 144332-75-2) is a chemical compound with the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. IUPAC name: (2S)-1-[(4-bromophenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: CGOZVRYXMLVHCE-NSHDSACASA-N.
| Molecular formula | C13H14BrNO4 |
|---|---|
| Molecular weight | 328.16 g/mol |
| IUPAC name | (2S)-1-[(4-bromophenyl)methoxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | CGOZVRYXMLVHCE-NSHDSACASA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)