CAS 2055119-08-7 is the registry number for tert-Butyl 4-bromo-6-hydroxy-1-oxo-3H-isoindole-2-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl 7-bromo-5-hydroxy-3-oxo-1H-isoindole-2-carboxylate (CAS 2055119-08-7) is a chemical compound with the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. IUPAC name: tert-butyl 7-bromo-5-hydroxy-3-oxo-1H-isoindole-2-carboxylate. InChIKey: MSVWZLFVZGNYCG-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO4 |
|---|---|
| Molecular weight | 328.16 g/mol |
| IUPAC name | tert-butyl 7-bromo-5-hydroxy-3-oxo-1H-isoindole-2-carboxylate |
| InChIKey | MSVWZLFVZGNYCG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=C(C1=O)C=C(C=C2Br)O |
Computed by PubChem (NCBI)