CAS 1638668-12-8 is the registry number for Dimethyl (R)-5-bromo-3,4-dihydroisoquinoline-2,3(1H)-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl (3R)-5-bromo-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate (CAS 1638668-12-8) is a chemical compound with the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. IUPAC name: dimethyl (3R)-5-bromo-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate. InChIKey: IAVCINLGBBDZKM-LLVKDONJSA-N.
| Molecular formula | C13H14BrNO4 |
|---|---|
| Molecular weight | 328.16 g/mol |
| IUPAC name | dimethyl (3R)-5-bromo-3,4-dihydro-1H-isoquinoline-2,3-dicarboxylate |
| InChIKey | IAVCINLGBBDZKM-LLVKDONJSA-N |
| SMILES | COC(=O)[C@H]1CC2=C(CN1C(=O)OC)C=CC=C2Br |
Computed by PubChem (NCBI)