Products 1305756-18-6
CAS 1305756-18-6 is the registry number for 3-Bromo-4-methoxy-n-((1-methyl-1h-pyrazol-4-yl)methyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-bromo-4-methoxy-N-[(1-methylpyrazol-4-yl)methyl]benzamide (CAS 1305756-18-6) is a chemical compound with the molecular formula C13H14BrN3O2 and a molecular weight of 324.17 g/mol. IUPAC name: 3-bromo-4-methoxy-N-[(1-methylpyrazol-4-yl)methyl]benzamide. InChIKey: UJNJJLIIJWOCCJ-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN3O2 |
|---|---|
| Molecular weight | 324.17 g/mol |
| IUPAC name | 3-bromo-4-methoxy-N-[(1-methylpyrazol-4-yl)methyl]benzamide |
| InChIKey | UJNJJLIIJWOCCJ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)CNC(=O)C2=CC(=C(C=C2)OC)Br |
Computed by PubChem (NCBI)