Products 1976800-34-6
CAS 1976800-34-6 appears in our catalog under these names: 3-((3-(1H-Imidazol-1-yl)propyl)amino)-5-bromobenzoic acid, 95%, 3-((3-(1H-Imidazol-1-yl)propyl)amino)-5-bromobenzoic acid, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 25mg, 10mg.
3-bromo-5-(3-imidazol-1-ylpropylamino)benzoic acid (CAS 1976800-34-6) is a chemical compound with the molecular formula C13H14BrN3O2 and a molecular weight of 324.17 g/mol. IUPAC name: 3-bromo-5-(3-imidazol-1-ylpropylamino)benzoic acid. InChIKey: JLZCSKQXYKUZCL-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN3O2 |
|---|---|
| Molecular weight | 324.17 g/mol |
| IUPAC name | 3-bromo-5-(3-imidazol-1-ylpropylamino)benzoic acid |
| InChIKey | JLZCSKQXYKUZCL-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)CCCNC2=CC(=CC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)