Products 1971269-86-9
CAS 1971269-86-9 appears in our catalog under these names: 3-((3-(1H-Pyrazol-1-yl)propyl)amino)-5-bromobenzoic acid, 97%, 97%, 3-((3-(1H-Pyrazol-1-yl)propyl)amino)-5-bromobenzoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 10mg, 25mg.
3-bromo-5-(3-pyrazol-1-ylpropylamino)benzoic acid (CAS 1971269-86-9) is a chemical compound with the molecular formula C13H14BrN3O2 and a molecular weight of 324.17 g/mol. IUPAC name: 3-bromo-5-(3-pyrazol-1-ylpropylamino)benzoic acid. InChIKey: KKMHRJDWFULVNC-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN3O2 |
|---|---|
| Molecular weight | 324.17 g/mol |
| IUPAC name | 3-bromo-5-(3-pyrazol-1-ylpropylamino)benzoic acid |
| InChIKey | KKMHRJDWFULVNC-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)CCCNC2=CC(=CC(=C2)C(=O)O)Br |
Computed by PubChem (NCBI)