Products 1820683-92-8
CAS 1820683-92-8 is the registry number for 1-(5-bromopyridin-2-yl)-5-tert-butylpyrazole-4-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(5-bromo-2-pyridinyl)-5-tert-butylpyrazole-4-carboxylic acid (CAS 1820683-92-8) is a chemical compound with the molecular formula C13H14BrN3O2 and a molecular weight of 324.17 g/mol. IUPAC name: 1-(5-bromo-2-pyridinyl)-5-tert-butylpyrazole-4-carboxylic acid. InChIKey: YTMRWNHQTFADKY-UHFFFAOYSA-N.
| Molecular formula | C13H14BrN3O2 |
|---|---|
| Molecular weight | 324.17 g/mol |
| IUPAC name | 1-(5-bromo-2-pyridinyl)-5-tert-butylpyrazole-4-carboxylic acid |
| InChIKey | YTMRWNHQTFADKY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=NN1C2=NC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)