CAS 1306605-46-8 appears in our catalog under these names: 4-(2-Amino-1,3-thiazol-4-yl)-5-methylfuran-2-carboxamide, 95%, 4-(2-Amino-1,3-thiazol-4-yl)-5-methylfuran-2-carboxamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-(2-amino-1,3-thiazol-4-yl)-5-methylfuran-2-carboxamide (CAS 1306605-46-8) is a chemical compound with the molecular formula C9H9N3O2S and a molecular weight of 223.25 g/mol. IUPAC name: 4-(2-amino-1,3-thiazol-4-yl)-5-methylfuran-2-carboxamide. InChIKey: IIFWPSIDMQDEHY-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2S |
|---|---|
| Molecular weight | 223.25 g/mol |
| IUPAC name | 4-(2-amino-1,3-thiazol-4-yl)-5-methylfuran-2-carboxamide |
| InChIKey | IIFWPSIDMQDEHY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(O1)C(=O)N)C2=CSC(=N2)N |
Computed by PubChem (NCBI)