CAS 1306606-52-9 appears in our catalog under these names: [3-(Pyridin-3-yl)-1,2,4-oxadiazol-5-yl]methanol hydrochloride, 95%, (3-(Pyridin-3-yl)-1,2,4-oxadiazol-5-yl)methanol hydrochloride, 95%, (3-(Pyridin-3-yl)-1,2,4-oxadiazol-5-yl)methanol hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methanol;hydrochloride (CAS 1306606-52-9) is a chemical compound with the molecular formula C8H8ClN3O2 and a molecular weight of 213.62 g/mol. IUPAC name: (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methanol;hydrochloride. InChIKey: SSMQGULADCRKDI-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O2 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | (3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methanol;hydrochloride |
| InChIKey | SSMQGULADCRKDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NOC(=N2)CO.Cl |
Computed by PubChem (NCBI)