CAS 2279124-20-6 is the registry number for 5-Aminopyrazolo[1,5-a]pyridine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-aminopyrazolo[1,5-a]pyridine-3-carboxylic acid;hydrochloride (CAS 2279124-20-6) is a chemical compound with the molecular formula C8H8ClN3O2 and a molecular weight of 213.62 g/mol. IUPAC name: 5-aminopyrazolo[1,5-a]pyridine-3-carboxylic acid;hydrochloride. InChIKey: CZZCLFBBQOWXDN-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O2 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 5-aminopyrazolo[1,5-a]pyridine-3-carboxylic acid;hydrochloride |
| InChIKey | CZZCLFBBQOWXDN-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)C(=O)O)C=C1N.Cl |
Computed by PubChem (NCBI)