Products 1951444-58-8
CAS 1951444-58-8 appears in our catalog under these names: 1-Methyl-5-nitro-1h-benzo[d]imidazole hydrochloride, 95%, 1-Methyl-5-nitro-1H-benzo(d)imidazole hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 25g.
1-methyl-5-nitrobenzimidazole;hydrochloride (CAS 1951444-58-8) is a chemical compound with the molecular formula C8H8ClN3O2 and a molecular weight of 213.62 g/mol. IUPAC name: 1-methyl-5-nitrobenzimidazole;hydrochloride. InChIKey: ZMHSNBCLYZAZSO-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O2 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 1-methyl-5-nitrobenzimidazole;hydrochloride |
| InChIKey | ZMHSNBCLYZAZSO-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1C=CC(=C2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)