CAS 2411310-61-5 is the registry number for 3-Methyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.
3-methyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid;hydrochloride (CAS 2411310-61-5) is a chemical compound with the molecular formula C8H8ClN3O2 and a molecular weight of 213.62 g/mol. IUPAC name: 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid;hydrochloride. InChIKey: BPUADBUERJBNDM-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O2 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 3-methyl-[1,2,4]triazolo[4,3-a]pyridine-8-carboxylic acid;hydrochloride |
| InChIKey | BPUADBUERJBNDM-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1C=CC=C2C(=O)O.Cl |
Computed by PubChem (NCBI)