CAS 1306728-51-7 is the registry number for (2S)-2-{[(tert-butoxy)carbonyl]amino}-3-(isoquinolin-5-yl)propanoic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(2S)-3-isoquinolin-5-yl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1306728-51-7) is a chemical compound with the molecular formula C17H20N2O4 and a molecular weight of 316.35 g/mol. IUPAC name: (2S)-3-isoquinolin-5-yl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KEOXUZZARZRNKN-AWEZNQCLSA-N.
| Molecular formula | C17H20N2O4 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | (2S)-3-isoquinolin-5-yl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KEOXUZZARZRNKN-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC2=C1C=CN=C2)C(=O)O |
Computed by PubChem (NCBI)