CAS 1307117-53-8 is the registry number for phenyl(2,4,6-trifluorophenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Phenyl-(2,4,6-trifluorophenyl)methanol (CAS 1307117-53-8) is a chemical compound with the molecular formula C13H9F3O and a molecular weight of 238.20 g/mol. IUPAC name: phenyl-(2,4,6-trifluorophenyl)methanol. InChIKey: UAGCSKQUVNACKL-UHFFFAOYSA-N.
| Molecular formula | C13H9F3O |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | phenyl-(2,4,6-trifluorophenyl)methanol |
| InChIKey | UAGCSKQUVNACKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C=C(C=C2F)F)F)O |
Computed by PubChem (NCBI)