Products 1307188-77-7
CAS 1307188-77-7 appears in our catalog under these names: H-Gly-tert-Leu-OH, 95%, (S)-2-(2-Aminoacetamido)-3,3-dimethylbutanoic acid, 97%, (S)-2-(2-Aminoacetamido)-3,3-dimethylbutanoic acid, 95%. Offered by: Ambeed, Fluorochem, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-[(2-aminoacetyl)amino]-3,3-dimethylbutanoic acid (CAS 1307188-77-7) is a chemical compound with the molecular formula C8H16N2O3 and a molecular weight of 188.22 g/mol. IUPAC name: (2S)-2-[(2-aminoacetyl)amino]-3,3-dimethylbutanoic acid. InChIKey: YUZFRZHDCMUDKG-ZCFIWIBFSA-N.
| Molecular formula | C8H16N2O3 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2S)-2-[(2-aminoacetyl)amino]-3,3-dimethylbutanoic acid |
| InChIKey | YUZFRZHDCMUDKG-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)CN |
Computed by PubChem (NCBI)