Products 1308061-19-9
CAS 1308061-19-9 appears in our catalog under these names: 2-Amino-6-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide 95%, 2-Amino-6-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide, 95%. Offered by: Ambeed. Available pack sizes: 5g, 25g, 1g.
2-amino-6-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide (CAS 1308061-19-9) is a chemical compound with the molecular formula C14H15ClN2O2S and a molecular weight of 310.8 g/mol. IUPAC name: 2-amino-6-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide. InChIKey: LUNWDVZFNLJBDV-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O2S |
|---|---|
| Molecular weight | 310.8 g/mol |
| IUPAC name | 2-amino-6-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide |
| InChIKey | LUNWDVZFNLJBDV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NS(=O)(=O)C2=C(C=CC=C2Cl)N)C |
Computed by PubChem (NCBI)