Products 146739-86-8
CAS 146739-86-8 is the registry number for S-2720. Offered by: MedChemExpress. Available pack sizes: Get quote.
Prop-1-en-2-yl 7-chloro-2,2-dimethyl-3-sulfanylidene-4H-quinoxaline-1-carboxylate (CAS 146739-86-8) is a chemical compound with the molecular formula C14H15ClN2O2S and a molecular weight of 310.8 g/mol. IUPAC name: prop-1-en-2-yl 7-chloro-2,2-dimethyl-3-sulfanylidene-4H-quinoxaline-1-carboxylate. InChIKey: UNOJVGJCKUQAGH-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O2S |
|---|---|
| Molecular weight | 310.8 g/mol |
| IUPAC name | prop-1-en-2-yl 7-chloro-2,2-dimethyl-3-sulfanylidene-4H-quinoxaline-1-carboxylate |
| InChIKey | UNOJVGJCKUQAGH-UHFFFAOYSA-N |
| SMILES | CC(=C)OC(=O)N1C2=C(C=CC(=C2)Cl)NC(=S)C1(C)C |
Computed by PubChem (NCBI)