Products 406927-70-6
CAS 406927-70-6 appears in our catalog under these names: 5-Amino-2-chloro-n-ethyl-n-phenyl-benzenesulfonamide, 95%, 5-Amino-2-chloro-N-ethyl-N-phenyl-benzenesulfonamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5-amino-2-chloro-N-ethyl-N-phenylbenzenesulfonamide (CAS 406927-70-6) is a chemical compound with the molecular formula C14H15ClN2O2S and a molecular weight of 310.8 g/mol. IUPAC name: 5-amino-2-chloro-N-ethyl-N-phenylbenzenesulfonamide. InChIKey: JFXYBBCWLFPDTC-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O2S |
|---|---|
| Molecular weight | 310.8 g/mol |
| IUPAC name | 5-amino-2-chloro-N-ethyl-N-phenylbenzenesulfonamide |
| InChIKey | JFXYBBCWLFPDTC-UHFFFAOYSA-N |
| SMILES | CCN(C1=CC=CC=C1)S(=O)(=O)C2=C(C=CC(=C2)N)Cl |
Computed by PubChem (NCBI)