CAS 71215-81-1 is the registry number for 5-Amino-2-chloro-n-(2,4-dimethylphenyl)benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
5-amino-2-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide (CAS 71215-81-1) is a chemical compound with the molecular formula C14H15ClN2O2S and a molecular weight of 310.8 g/mol. IUPAC name: 5-amino-2-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide. InChIKey: SOWYLSRVTBKKJE-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O2S |
|---|---|
| Molecular weight | 310.8 g/mol |
| IUPAC name | 5-amino-2-chloro-N-(2,4-dimethylphenyl)benzenesulfonamide |
| InChIKey | SOWYLSRVTBKKJE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NS(=O)(=O)C2=C(C=CC(=C2)N)Cl)C |
Computed by PubChem (NCBI)