CAS 13082-34-3 appears in our catalog under these names: 1-Cyclopropyl-2,2,2-trifluoro-1-phenylethan-1-ol, 95%, 1-Cyclopropyl-2,2,2-trifluoro-1-phenylethan-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-cyclopropyl-2,2,2-trifluoro-1-phenylethanol (CAS 13082-34-3) is a chemical compound with the molecular formula C11H11F3O and a molecular weight of 216.20 g/mol. IUPAC name: 1-cyclopropyl-2,2,2-trifluoro-1-phenylethanol. InChIKey: KRHLCHSAMBEJFD-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O |
|---|---|
| Molecular weight | 216.20 g/mol |
| IUPAC name | 1-cyclopropyl-2,2,2-trifluoro-1-phenylethanol |
| InChIKey | KRHLCHSAMBEJFD-UHFFFAOYSA-N |
| SMILES | C1CC1C(C2=CC=CC=C2)(C(F)(F)F)O |
Computed by PubChem (NCBI)