Products 1308264-52-9
CAS 1308264-52-9 appears in our catalog under these names: L-ASPARTIC-15N,2,3,3-D3 ACID 98 ATOM % &, L-Aspartic acid-15N,d3, 98.0%. Offered by: Sigma-Aldrich, MedChemExpress. Available pack sizes: 250MG, 50 mg.
(2S)-2-(15N)azanyl-2,3,3-trideuteriobutanedioic acid (CAS 1308264-52-9) is a chemical compound with the molecular formula C4H7NO4 and a molecular weight of 137.11 g/mol. IUPAC name: (2S)-2-(15N)azanyl-2,3,3-trideuteriobutanedioic acid. InChIKey: CKLJMWTZIZZHCS-GJISNYTCSA-N.
| Molecular formula | C4H7NO4 |
|---|---|
| Molecular weight | 137.11 g/mol |
| IUPAC name | (2S)-2-(15N)azanyl-2,3,3-trideuteriobutanedioic acid |
| InChIKey | CKLJMWTZIZZHCS-GJISNYTCSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])C(=O)O)[15NH2] |
Computed by PubChem (NCBI)