Products 1308311-03-6
CAS 1308311-03-6 appears in our catalog under these names: (S)-2-(6-Methylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole, 97%, 97%, (S)-2-(6-Methylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole, 98%, (S)-2-(6-Methylpyridin-2-yl)-4-phenyl-4,5-dihydrooxazole, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg.
(4S)-2-(6-methyl-2-pyridinyl)-4-phenyl-4,5-dihydro-1,3-oxazole (CAS 1308311-03-6) is a chemical compound with the molecular formula C15H14N2O and a molecular weight of 238.28 g/mol. IUPAC name: (4S)-2-(6-methyl-2-pyridinyl)-4-phenyl-4,5-dihydro-1,3-oxazole. InChIKey: ZBYAUOZWGYIGNW-CQSZACIVSA-N.
| Molecular formula | C15H14N2O |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | (4S)-2-(6-methyl-2-pyridinyl)-4-phenyl-4,5-dihydro-1,3-oxazole |
| InChIKey | ZBYAUOZWGYIGNW-CQSZACIVSA-N |
| SMILES | CC1=NC(=CC=C1)C2=N[C@H](CO2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)