Products 1308451-40-2
CAS 1308451-40-2 is the registry number for 2-Bromo-4-fluoro-N-(1H-indol-5-yl)benzamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-4-fluoro-N-(1H-indol-5-yl)benzamide (CAS 1308451-40-2) is a chemical compound with the molecular formula C15H10BrFN2O and a molecular weight of 333.15 g/mol. IUPAC name: 2-bromo-4-fluoro-N-(1H-indol-5-yl)benzamide. InChIKey: IRRXURZAWFUCRE-UHFFFAOYSA-N.
| Molecular formula | C15H10BrFN2O |
|---|---|
| Molecular weight | 333.15 g/mol |
| IUPAC name | 2-bromo-4-fluoro-N-(1H-indol-5-yl)benzamide |
| InChIKey | IRRXURZAWFUCRE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN2)C=C1NC(=O)C3=C(C=C(C=C3)F)Br |
Computed by PubChem (NCBI)