CAS 153873-96-2 appears in our catalog under these names: 5-(2-Bromophenyl)-7-fluoro-1,3-dihydro-2H-1,4-benzodiazepin-2-one (Flubromazepam Isomer), 5-(2-Bromophenyl)-7-fluoro-1,3-dihydro-2H-1,4-benzodiazepin-2-one (Flubromazepam Isomer) 1.0 mg/ml in Methanol. Offered by: LoGiCal. Available pack sizes: 10mg, 1ml.
5-(2-bromophenyl)-7-fluoro-1,3-dihydro-1,4-benzodiazepin-2-one (CAS 153873-96-2) is a chemical compound with the molecular formula C15H10BrFN2O and a molecular weight of 333.15 g/mol. IUPAC name: 5-(2-bromophenyl)-7-fluoro-1,3-dihydro-1,4-benzodiazepin-2-one. InChIKey: APTIFBSTEIXFOB-UHFFFAOYSA-N.
| Molecular formula | C15H10BrFN2O |
|---|---|
| Molecular weight | 333.15 g/mol |
| IUPAC name | 5-(2-bromophenyl)-7-fluoro-1,3-dihydro-1,4-benzodiazepin-2-one |
| InChIKey | APTIFBSTEIXFOB-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=C(C=C2)F)C(=N1)C3=CC=CC=C3Br |
Computed by PubChem (NCBI)