CAS 1308849-85-5 is the registry number for 3,5-Difluoro-4-formyl-n-methylbenzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
3,5-difluoro-4-formyl-N-methylbenzamide (CAS 1308849-85-5) is a chemical compound with the molecular formula C9H7F2NO2 and a molecular weight of 199.15 g/mol. IUPAC name: 3,5-difluoro-4-formyl-N-methylbenzamide. InChIKey: MZHDMPFPVYDUQZ-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO2 |
|---|---|
| Molecular weight | 199.15 g/mol |
| IUPAC name | 3,5-difluoro-4-formyl-N-methylbenzamide |
| InChIKey | MZHDMPFPVYDUQZ-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=C(C(=C1)F)C=O)F |
Computed by PubChem (NCBI)