CAS 54672-46-7 is the registry number for 1–(2,2–difluorocyclopropyl)–3–nitrobenzene. Offered by: GLPBio. Available pack sizes: 1g, 500mg.
1-(2,2-difluorocyclopropyl)-3-nitrobenzene (CAS 54672-46-7) is a chemical compound with the molecular formula C9H7F2NO2 and a molecular weight of 199.15 g/mol. IUPAC name: 1-(2,2-difluorocyclopropyl)-3-nitrobenzene. InChIKey: RSYAKDQQWWHLKV-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO2 |
|---|---|
| Molecular weight | 199.15 g/mol |
| IUPAC name | 1-(2,2-difluorocyclopropyl)-3-nitrobenzene |
| InChIKey | RSYAKDQQWWHLKV-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)