CAS 2847886-62-6 is the registry number for 4,5-Difluoro-6-(hydroxymethyl)isoindolin-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-difluoro-6-(hydroxymethyl)-2,3-dihydroisoindol-1-one (CAS 2847886-62-6) is a chemical compound with the molecular formula C9H7F2NO2 and a molecular weight of 199.15 g/mol. IUPAC name: 4,5-difluoro-6-(hydroxymethyl)-2,3-dihydroisoindol-1-one. InChIKey: CPZZIBKYJYZLPK-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO2 |
|---|---|
| Molecular weight | 199.15 g/mol |
| IUPAC name | 4,5-difluoro-6-(hydroxymethyl)-2,3-dihydroisoindol-1-one |
| InChIKey | CPZZIBKYJYZLPK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C(=C2F)F)CO)C(=O)N1 |
Computed by PubChem (NCBI)