CAS 1393560-43-4 appears in our catalog under these names: 3,3-Difluoro-6-methoxyindolin-2-one, 95%, 2H-Indol-2-one, 3,3-difluoro-1,3-dihydro-6-methoxy-, 97%, 3,3-Difluoro-6-methoxy-2,3-dihydro-1H-indol-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
3,3-difluoro-6-methoxy-1H-indol-2-one (CAS 1393560-43-4) is a chemical compound with the molecular formula C9H7F2NO2 and a molecular weight of 199.15 g/mol. IUPAC name: 3,3-difluoro-6-methoxy-1H-indol-2-one. InChIKey: RTJFCSUUOUEDHP-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO2 |
|---|---|
| Molecular weight | 199.15 g/mol |
| IUPAC name | 3,3-difluoro-6-methoxy-1H-indol-2-one |
| InChIKey | RTJFCSUUOUEDHP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(C(=O)N2)(F)F |
Computed by PubChem (NCBI)