Products 1309123-33-8

CAS 1309123-33-8 is the registry number for 5-Iodobenzo[d][1,3]dioxole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-iodo-1,3-benzodioxole-4-carboxylic acid (CAS 1309123-33-8) is a chemical compound with the molecular formula C8H5IO4 and a molecular weight of 292.03 g/mol. IUPAC name: 5-iodo-1,3-benzodioxole-4-carboxylic acid. InChIKey: PSUVDLFGWJDIKZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5IO4
Molecular weight292.03 g/mol
IUPAC name5-iodo-1,3-benzodioxole-4-carboxylic acid
InChIKeyPSUVDLFGWJDIKZ-UHFFFAOYSA-N
SMILESC1OC2=C(O1)C(=C(C=C2)I)C(=O)O

Computed by PubChem (NCBI)