CAS 1309123-33-8 is the registry number for 5-Iodobenzo[d][1,3]dioxole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-iodo-1,3-benzodioxole-4-carboxylic acid (CAS 1309123-33-8) is a chemical compound with the molecular formula C8H5IO4 and a molecular weight of 292.03 g/mol. IUPAC name: 5-iodo-1,3-benzodioxole-4-carboxylic acid. InChIKey: PSUVDLFGWJDIKZ-UHFFFAOYSA-N.
| Molecular formula | C8H5IO4 |
|---|---|
| Molecular weight | 292.03 g/mol |
| IUPAC name | 5-iodo-1,3-benzodioxole-4-carboxylic acid |
| InChIKey | PSUVDLFGWJDIKZ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)I)C(=O)O |
Computed by PubChem (NCBI)