CAS 6937-34-4 appears in our catalog under these names: 3–Iodophthalic acid, 3-Iodophthalic acid, 97% , 3-Iodophthalic acid 95%, 1,2-Benzenedicarboxylic acid, 3-iodo-, 95%, 95%, 3-Iodophthalic acid, 97%. Offered by: GLPBio, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 10g, 1g, 5g, 100g.
3-iodophthalic acid (CAS 6937-34-4) is a chemical compound with the molecular formula C8H5IO4 and a molecular weight of 292.03 g/mol. IUPAC name: 3-iodophthalic acid. InChIKey: HNPVERUJGFNNRV-UHFFFAOYSA-N.
| Molecular formula | C8H5IO4 |
|---|---|
| Molecular weight | 292.03 g/mol |
| IUPAC name | 3-iodophthalic acid |
| InChIKey | HNPVERUJGFNNRV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)I)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)