CAS 51839-16-8 appears in our catalog under these names: 5-Iodo-1,3-benzenedicarboxylic acid, 97%, 97%, 5-Iodoisophthalic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
5-iodobenzene-1,3-dicarboxylic acid (CAS 51839-16-8) is a chemical compound with the molecular formula C8H5IO4 and a molecular weight of 292.03 g/mol. IUPAC name: 5-iodobenzene-1,3-dicarboxylic acid. InChIKey: QMDFYAWUWIIQFM-UHFFFAOYSA-N.
| Molecular formula | C8H5IO4 |
|---|---|
| Molecular weight | 292.03 g/mol |
| IUPAC name | 5-iodobenzene-1,3-dicarboxylic acid |
| InChIKey | QMDFYAWUWIIQFM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)I)C(=O)O |
Computed by PubChem (NCBI)