Products 60229-66-5
CAS 60229-66-5 is the registry number for 6-Iodobenzo[d][1,3]dioxole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-iodo-1,3-benzodioxole-5-carboxylic acid (CAS 60229-66-5) is a chemical compound with the molecular formula C8H5IO4 and a molecular weight of 292.03 g/mol. IUPAC name: 6-iodo-1,3-benzodioxole-5-carboxylic acid. InChIKey: SQBYWTMIZZBMAU-UHFFFAOYSA-N.
| Molecular formula | C8H5IO4 |
|---|---|
| Molecular weight | 292.03 g/mol |
| IUPAC name | 6-iodo-1,3-benzodioxole-5-carboxylic acid |
| InChIKey | SQBYWTMIZZBMAU-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C(=O)O)I |
Computed by PubChem (NCBI)