CAS 13092-93-8 appears in our catalog under these names: 4-Formyl-n-methylbenzenesulfonamide, 95%, 4-Formyl-N-methylbenzenesulfonamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 1000mg, 2000mg.
4-formyl-N-methylbenzenesulfonamide (CAS 13092-93-8) is a chemical compound with the molecular formula C8H9NO3S and a molecular weight of 199.23 g/mol. IUPAC name: 4-formyl-N-methylbenzenesulfonamide. InChIKey: OPTKITMTUSAJRP-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3S |
|---|---|
| Molecular weight | 199.23 g/mol |
| IUPAC name | 4-formyl-N-methylbenzenesulfonamide |
| InChIKey | OPTKITMTUSAJRP-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)