Products 1309379-15-4

CAS 1309379-15-4 is the registry number for 7-Chloro-1,6-naphthyridine. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 1g, 0,5g, 2g, 5g.

Structural formula: {0} (CAS {1})

7-chloro-1,6-naphthyridine (CAS 1309379-15-4) is a chemical compound with the molecular formula C8H5ClN2 and a molecular weight of 164.59 g/mol. IUPAC name: 7-chloro-1,6-naphthyridine. InChIKey: XJYYMFMRGZRUKP-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5ClN2
Molecular weight164.59 g/mol
IUPAC name7-chloro-1,6-naphthyridine
InChIKeyXJYYMFMRGZRUKP-UHFFFAOYSA-N
SMILESC1=CC2=CN=C(C=C2N=C1)Cl

Computed by PubChem (NCBI)