CAS 1309602-06-9 is the registry number for 1-(2,2-difluoroethoxy)-1,1,2,3,3,3-hexafluoropropane, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(2,2-difluoroethoxy)-1,1,2,3,3,3-hexafluoropropane (CAS 1309602-06-9) is a chemical compound with the molecular formula C5H4F8O and a molecular weight of 232.07 g/mol. IUPAC name: 1-(2,2-difluoroethoxy)-1,1,2,3,3,3-hexafluoropropane. InChIKey: ZECYXTJLYXGPOQ-UHFFFAOYSA-N.
| Molecular formula | C5H4F8O |
|---|---|
| Molecular weight | 232.07 g/mol |
| IUPAC name | 1-(2,2-difluoroethoxy)-1,1,2,3,3,3-hexafluoropropane |
| InChIKey | ZECYXTJLYXGPOQ-UHFFFAOYSA-N |
| SMILES | C(C(F)F)OC(C(C(F)(F)F)F)(F)F |
Computed by PubChem (NCBI)