CAS 16627-68-2 appears in our catalog under these names: 1,1,2,2-Tetrafluoroethyl-2,2,3,3-tetrafluoropropyl ether, 98%, 1,1,2,2–Tetrafluoroethyl 2,2,3,3–Tetrafluoropropyl Ether, 1,1,2,2-Tetrafluoroethyl 2,2,3,3-Tetrafluoropropyl Ether, >95.0%(GC), 1,1,2,2-Tetrafluoroethyl2,2,3,3-tetrafluoropropylether 95% (stabilized with BHT), 1,1,2,2-TETRAFLUOROETHYL 2,2,3,3-TETRAF&. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 500g, 100g, 5g, 50G, 1g, 10g.
1,1,2,2-tetrafluoro-3-(1,1,2,2-tetrafluoroethoxy)propane (CAS 16627-68-2) is a chemical compound with the molecular formula C5H4F8O and a molecular weight of 232.07 g/mol. IUPAC name: 1,1,2,2-tetrafluoro-3-(1,1,2,2-tetrafluoroethoxy)propane. InChIKey: HCBRSIIGBBDDCD-UHFFFAOYSA-N.
| Molecular formula | C5H4F8O |
|---|---|
| Molecular weight | 232.07 g/mol |
| IUPAC name | 1,1,2,2-tetrafluoro-3-(1,1,2,2-tetrafluoroethoxy)propane |
| InChIKey | HCBRSIIGBBDDCD-UHFFFAOYSA-N |
| SMILES | C(C(C(F)F)(F)F)OC(C(F)F)(F)F |
Computed by PubChem (NCBI)