CAS 355-80-6 appears in our catalog under these names: 2,2,3,3,4,4,5,5-Octafluoro-1-pentanol, >95% (GC), 2,2,3,3,4,4,5,5–Octafluoro–1–pentanol, 2,2,3,3,4,4,5,5-Octafluoro-1-pentanol, 98% , 2,2,3,3,4,4,5,5-Octafluoro-1-pentanol, >98.0%(GC), 2,2,3,3,4,4,5,5-OCTAFLUORO-1-PENTANOL, &. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich. Available pack sizes: 2,5g, 250mg, 500mg, 500g, 25g, 100g, 5g, 10kg.
2,2,3,3,4,4,5,5-octafluoropentan-1-ol (CAS 355-80-6) is a chemical compound with the molecular formula C5H4F8O and a molecular weight of 232.07 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octafluoropentan-1-ol. InChIKey: JUGSKHLZINSXPQ-UHFFFAOYSA-N.
| Molecular formula | C5H4F8O |
|---|---|
| Molecular weight | 232.07 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octafluoropentan-1-ol |
| InChIKey | JUGSKHLZINSXPQ-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)