Products 382-26-3

CAS 382-26-3 is the registry number for 1,1,3,3,3-Pentafluoro-2-trifluoromethylpropyl methyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 100g.

Structural formula: {0} (CAS {1})

2-[difluoro(methoxy)methyl]-1,1,1,3,3,3-hexafluoropropane (CAS 382-26-3) is a chemical compound with the molecular formula C5H4F8O and a molecular weight of 232.07 g/mol. IUPAC name: 2-[difluoro(methoxy)methyl]-1,1,1,3,3,3-hexafluoropropane. InChIKey: AQHKYFLVHBIQMS-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4F8O
Molecular weight232.07 g/mol
IUPAC name2-[difluoro(methoxy)methyl]-1,1,1,3,3,3-hexafluoropropane
InChIKeyAQHKYFLVHBIQMS-UHFFFAOYSA-N
SMILESCOC(C(C(F)(F)F)C(F)(F)F)(F)F

Computed by PubChem (NCBI)