CAS 1309686-09-6 is the registry number for Oxybuprocaine Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-butoxy-4-nitrobenzoate (CAS 1309686-09-6) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: methyl 3-butoxy-4-nitrobenzoate. InChIKey: VLGXDZCLZPGAHT-UHFFFAOYSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | methyl 3-butoxy-4-nitrobenzoate |
| InChIKey | VLGXDZCLZPGAHT-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(C=CC(=C1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)