Products 1309874-27-8
CAS 1309874-27-8 is the registry number for 6-Bromo-4,5-dimethyl-1,8-naphthyridin-2(1H)-one. Offered by: TRC. Available pack sizes: 250mg.
6-bromo-4,5-dimethyl-1H-1,8-naphthyridin-2-one (CAS 1309874-27-8) is a chemical compound with the molecular formula C10H9BrN2O and a molecular weight of 253.09 g/mol. IUPAC name: 6-bromo-4,5-dimethyl-1H-1,8-naphthyridin-2-one. InChIKey: QHWKHVYHWGZHSI-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O |
|---|---|
| Molecular weight | 253.09 g/mol |
| IUPAC name | 6-bromo-4,5-dimethyl-1H-1,8-naphthyridin-2-one |
| InChIKey | QHWKHVYHWGZHSI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)NC2=NC=C(C(=C12)C)Br |
Computed by PubChem (NCBI)