CAS 131-76-0 is the registry number for Benzofuran-2,3-dicarboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
1-benzofuran-2,3-dicarboxylic acid (CAS 131-76-0) is a chemical compound with the molecular formula C10H6O5 and a molecular weight of 206.15 g/mol. IUPAC name: 1-benzofuran-2,3-dicarboxylic acid. InChIKey: FAEMVAVNTRSKEZ-UHFFFAOYSA-N.
| Molecular formula | C10H6O5 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | 1-benzofuran-2,3-dicarboxylic acid |
| InChIKey | FAEMVAVNTRSKEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(O2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)